4-bromo-6-fluoroquinoline
Catalog No: FT-0755819
CAS No: 661463-17-8
- Chemical Name: 4-bromo-6-fluoroquinoline
- Molecular Formula: C9H5BrFN
- Molecular Weight: 226.04
- InChI Key: HIWPTYUKGHNQCU-UHFFFAOYSA-N
- InChI: InChI=1S/C9H5BrFN/c10-8-3-4-12-9-2-1-6(11)5-7(8)9/h1-5H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 661463-17-8 |
|---|---|
| MF: | C9H5BrFN |
| Density: | 1.6±0.1 g/cm3 |
| Flash_Point: | 135.1±21.8 °C |
| Melting_Point: | N/A |
| Product_Name: | 4-Bromo-6-fluoroquinoline |
| Symbol: | GHS05, GHS07 |
| Bolling_Point: | 299.7±20.0 °C at 760 mmHg |
| FW: | 226.045 |
| Bolling_Point: | 299.7±20.0 °C at 760 mmHg |
|---|---|
| Density: | 1.6±0.1 g/cm3 |
| MF: | C9H5BrFN |
| LogP: | 2.83 |
| Exact_Mass: | 224.958939 |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Flash_Point: | 135.1±21.8 °C |
| FW: | 226.045 |
| Refractive_Index: | 1.647 |
| PSA: | 12.89000 |
| Symbol: | GHS05, GHS07 |
|---|---|
| Safety_Statements: | H302-H318 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P280-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)